C24H18F3NO6 — CID 19541108
(E)-1-[3-(difluoromethoxy)phenyl]-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19541108) has the molecular formula C24H18F3NO6 and a molecular weight of 473.40 g/mol. Its IUPAC name is (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19541108 |
| Molecular Formula | C24H18F3NO6 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(OC(F)F)c2)cc1COc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18F3NO6/c1-32-22-10-6-15(5-9-21(29)16-3-2-4-19(12-16)34-24(26)27)11-17(22)14-33-23-13-18(25)7-8-20(23)28(30)31/h2-13,24H,14H2,1H3/b9-5+ |
| InChIKey | FERFYWNFFJFFCR-WEVVVXLNSA-N |
| XLogP | 5.82 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|