C30H24F2O4 — CID 19542725
(E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19542725) has the molecular formula C30H24F2O4 and a molecular weight of 486.51 g/mol. Its IUPAC name is (E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542725 |
| Molecular Formula | C30H24F2O4 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(OC(F)F)c2)cc1COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24F2O4/c1-34-29-17-11-21(10-16-28(33)24-8-5-9-27(19-24)36-30(31)32)18-25(29)20-35-26-14-12-23(13-15-26)22-6-3-2-4-7-22/h2-19,30H,20H2,1H3/b16-10+ |
| InChIKey | JAPAWSADTYHWMU-MHWRWJLKSA-N |
| XLogP | 7.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|