C25H21BrF2O5 — CID 19543082
(E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one (PubChem CID 19543082) has the molecular formula C25H21BrF2O5 and a molecular weight of 519.34 g/mol. Its IUPAC name is (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19543082 |
| Molecular Formula | C25H21BrF2O5 |
| Molecular Weight | 519.34 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC(F)F)c(OC)c2)cc1COc1cccc(Br)c1 |
| InChI | InChI=1S/C25H21BrF2O5/c1-30-22-10-7-16(12-18(22)15-32-20-5-3-4-19(26)14-20)6-9-21(29)17-8-11-23(33-25(27)28)24(13-17)31-2/h3-14,25H,15H2,1-2H3/b9-6+ |
| InChIKey | HVVACIZNHMQODR-RMKNXTFCSA-N |
| XLogP | 6.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.34 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|