C23H19BrO4 — CID 19564846
(E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 19564846) has the molecular formula C23H19BrO4 and a molecular weight of 439.31 g/mol. Its IUPAC name is (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19564846 |
| Molecular Formula | C23H19BrO4 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(O)cc2)cc1COc1cccc(Br)c1 |
| InChI | InChI=1S/C23H19BrO4/c1-27-23-12-6-16(5-11-22(26)17-7-9-20(25)10-8-17)13-18(23)15-28-21-4-2-3-19(24)14-21/h2-14,25H,15H2,1H3/b11-5+ |
| InChIKey | BVJRKBQEWMSCHA-VZUCSPMQSA-N |
| XLogP | 5.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|