C24H21BrO3 — CID 19570994
(E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(3-methylphenyl)prop-2-en-1-one (PubChem CID 19570994) has the molecular formula C24H21BrO3 and a molecular weight of 437.33 g/mol. Its IUPAC name is (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19570994 |
| Molecular Formula | C24H21BrO3 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (E)-3-[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]-1-(3-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(C)c2)cc1COc1cccc(Br)c1 |
| InChI | InChI=1S/C24H21BrO3/c1-17-5-3-6-19(13-17)23(26)11-9-18-10-12-24(27-2)20(14-18)16-28-22-8-4-7-21(25)15-22/h3-15H,16H2,1-2H3/b11-9+ |
| InChIKey | MTYLPFRTXQPBGU-PKNBQFBNSA-N |
| XLogP | 6.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|