C24H17F5O3 — CID 19570905
(E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one (PubChem CID 19570905) has the molecular formula C24H17F5O3 and a molecular weight of 448.39 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19570905 |
| Molecular Formula | C24H17F5O3 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(3-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(C)c2)cc1COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H17F5O3/c1-13-4-3-5-15(10-13)17(30)8-6-14-7-9-18(31-2)16(11-14)12-32-24-22(28)20(26)19(25)21(27)23(24)29/h3-11H,12H2,1-2H3/b8-6+ |
| InChIKey | MZJAUZUVCYSDJI-SOFGYWHQSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|