C21H15F5N2O3 — CID 19565313
(E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one (PubChem CID 19565313) has the molecular formula C21H15F5N2O3 and a molecular weight of 438.35 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19565313 |
| Molecular Formula | C21H15F5N2O3 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccn(C)n2)cc1COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H15F5N2O3/c1-28-8-7-13(27-28)14(29)5-3-11-4-6-15(30-2)12(9-11)10-31-21-19(25)17(23)16(22)18(24)20(21)26/h3-9H,10H2,1-2H3/b5-3+ |
| InChIKey | GTLDIDDSMIMRHQ-HWKANZROSA-N |
| XLogP | 4.60 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|