C21H19N3O5 — CID 19565312
(E)-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one (PubChem CID 19565312) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19565312 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]-1-(1-methylpyrazol-3-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccn(C)n2)cc1COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19N3O5/c1-23-12-11-17(22-23)19(25)9-7-15-8-10-20(28-2)16(13-15)14-29-21-6-4-3-5-18(21)24(26)27/h3-13H,14H2,1-2H3/b9-7+ |
| InChIKey | ZKBGGCLEZABXLU-VQHVLOKHSA-N |
| XLogP | 3.81 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|