C25H21F2NO7 — CID 19542997
(E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19542997) has the molecular formula C25H21F2NO7 and a molecular weight of 485.44 g/mol. Its IUPAC name is (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542997 |
| Molecular Formula | C25H21F2NO7 |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC(F)F)c(OC)c2)cc1COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21F2NO7/c1-32-21-11-8-16(13-18(21)15-34-22-6-4-3-5-19(22)28(30)31)7-10-20(29)17-9-12-23(35-25(26)27)24(14-17)33-2/h3-14,25H,15H2,1-2H3/b10-7+ |
| InChIKey | CLJIPXATSYGYHH-JXMROGBWSA-N |
| XLogP | 5.69 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|