C25H21F2NO6 — CID 19542727
(E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19542727) has the molecular formula C25H21F2NO6 and a molecular weight of 469.44 g/mol. Its IUPAC name is (E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542727 |
| Molecular Formula | C25H21F2NO6 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (E)-1-[3-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(5-methyl-2-nitrophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(OC(F)F)c2)cc1COc1cc(C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21F2NO6/c1-16-6-9-21(28(30)31)24(12-16)33-15-19-13-17(8-11-23(19)32-2)7-10-22(29)18-4-3-5-20(14-18)34-25(26)27/h3-14,25H,15H2,1-2H3/b10-7+ |
| InChIKey | TWGNHKMOYXUCQX-JXMROGBWSA-N |
| XLogP | 5.99 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|