C24H18Cl2F2O4 — CID 19542718
(E)-3-[3-[(2,6-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-[3-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 19542718) has the molecular formula C24H18Cl2F2O4 and a molecular weight of 479.31 g/mol. Its IUPAC name is (E)-3-[3-[(2,6-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-[3-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2,6-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-[3-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542718 |
| Molecular Formula | C24H18Cl2F2O4 |
| Molecular Weight | 479.31 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | (E)-3-[3-[(2,6-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-[3-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccc(OC(F)F)c2)cc1COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H18Cl2F2O4/c1-30-22-11-9-15(12-17(22)14-31-23-19(25)6-3-7-20(23)26)8-10-21(29)16-4-2-5-18(13-16)32-24(27)28/h2-13,24H,14H2,1H3/b10-8+ |
| InChIKey | ONXZZZHOBOXAEU-CSKARUKUSA-N |
| XLogP | 7.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.31 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|