C25H17F7O5 — CID 19542998
(E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19542998) has the molecular formula C25H17F7O5 and a molecular weight of 530.39 g/mol. Its IUPAC name is (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542998 |
| Molecular Formula | C25H17F7O5 |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | (E)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC(F)F)c(OC)c2)cc1COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H17F7O5/c1-34-16-7-4-12(3-6-15(33)13-5-8-17(37-25(31)32)18(10-13)35-2)9-14(16)11-36-24-22(29)20(27)19(26)21(28)23(24)30/h3-10,25H,11H2,1-2H3/b6-3+ |
| InChIKey | WLXYOEMSLVPATM-ZZXKWVIFSA-N |
| XLogP | 6.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|