C24H17Br3F2O4 — CID 19542767
(E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19542767) has the molecular formula C24H17Br3F2O4 and a molecular weight of 647.10 g/mol. Its IUPAC name is (E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19542767 |
| Molecular Formula | C24H17Br3F2O4 |
| Molecular Weight | 647.10 g/mol |
| Exact Mass | 643.86 |
| IUPAC Name | (E)-1-[4-(difluoromethoxy)phenyl]-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC(F)F)cc2)cc1COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C24H17Br3F2O4/c1-31-22-9-3-14(2-8-21(30)15-4-6-18(7-5-15)33-24(28)29)10-16(22)13-32-23-19(26)11-17(25)12-20(23)27/h2-12,24H,13H2,1H3/b8-2+ |
| InChIKey | HEWDATHBNJYRFH-KRXBUXKQSA-N |
| XLogP | 8.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.10 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|