C20H17Br3O3 — CID 19558784
(E)-1-cyclopropyl-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19558784) has the molecular formula C20H17Br3O3 and a molecular weight of 545.07 g/mol. Its IUPAC name is (E)-1-cyclopropyl-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-cyclopropyl-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19558784 |
| Molecular Formula | C20H17Br3O3 |
| Molecular Weight | 545.07 g/mol |
| Exact Mass | 541.87 |
| IUPAC Name | (E)-1-cyclopropyl-3-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)C2CC2)cc1COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C20H17Br3O3/c1-25-19-7-3-12(2-6-18(24)13-4-5-13)8-14(19)11-26-20-16(22)9-15(21)10-17(20)23/h2-3,6-10,13H,4-5,11H2,1H3/b6-2+ |
| InChIKey | CLKRGABPFOKRQU-QHHAFSJGSA-N |
| XLogP | 6.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.07 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|