C24H17Cl5O4 — CID 19566894
(E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 19566894) has the molecular formula C24H17Cl5O4 and a molecular weight of 546.66 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19566894 |
| Molecular Formula | C24H17Cl5O4 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 543.96 |
| IUPAC Name | (E)-3-[4-methoxy-3-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccccc2OC)cc1COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C24H17Cl5O4/c1-31-17-10-8-13(7-9-16(30)15-5-3-4-6-18(15)32-2)11-14(17)12-33-24-22(28)20(26)19(25)21(27)23(24)29/h3-11H,12H2,1-2H3/b9-7+ |
| InChIKey | OVPJWBPMQSVSOJ-VQHVLOKHSA-N |
| XLogP | 8.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|