C25H23FO5 — CID 19568880
(E)-1-(2,5-dimethoxyphenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19568880) has the molecular formula C25H23FO5 and a molecular weight of 422.45 g/mol. Its IUPAC name is (E)-1-(2,5-dimethoxyphenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethoxyphenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19568880 |
| Molecular Formula | C25H23FO5 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (E)-1-(2,5-dimethoxyphenyl)-3-[3-[(2-fluorophenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2ccc(OC)c(COc3ccccc3F)c2)c1 |
| InChI | InChI=1S/C25H23FO5/c1-28-19-10-13-24(30-3)20(15-19)22(27)11-8-17-9-12-23(29-2)18(14-17)16-31-25-7-5-4-6-21(25)26/h4-15H,16H2,1-3H3/b11-8+ |
| InChIKey | COKCOVGKMCBQHD-DHZHZOJOSA-N |
| XLogP | 5.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|