C24H23Br3N2O3S — CID 19547667
(5E)-3-cyclohexyl-5-[[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547667) has the molecular formula C24H23Br3N2O3S and a molecular weight of 659.24 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-5-[[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-5-[[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547667 |
| Molecular Formula | C24H23Br3N2O3S |
| Molecular Weight | 659.24 g/mol |
| Exact Mass | 655.90 |
| IUPAC Name | (5E)-3-cyclohexyl-5-[[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(C3CCCCC3)C2=O)cc1COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C24H23Br3N2O3S/c1-31-21-8-7-14(9-15(21)13-32-22-18(26)11-16(25)12-19(22)27)10-20-23(30)29(24(33)28-20)17-5-3-2-4-6-17/h7-12,17H,2-6,13H2,1H3,(H,28,33)/b20-10+ |
| InChIKey | RRLZOOJSXRMSAF-KEBDBYFISA-N |
| XLogP | 6.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.24 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|