C23H21Br2FN2O2S — CID 126095037
(5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 126095037) has the molecular formula C23H21Br2FN2O2S and a molecular weight of 568.31 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126095037 |
| Molecular Formula | C23H21Br2FN2O2S |
| Molecular Weight | 568.31 g/mol |
| Exact Mass | 565.97 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)c(OCc3cccc(F)c3)c(Br)c2)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C23H21Br2FN2O2S/c24-18-10-15(11-19(25)21(18)30-13-14-5-4-6-16(26)9-14)12-20-22(29)28(23(31)27-20)17-7-2-1-3-8-17/h4-6,9-12,17H,1-3,7-8,13H2,(H,27,31)/b20-12- |
| InChIKey | GLJUGPAHEJSRET-NDENLUEZSA-N |
| XLogP | 6.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.31 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|