C23H22Cl2N2O2S — CID 124540993
(5Z)-3-cyclohexyl-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 124540993) has the molecular formula C23H22Cl2N2O2S and a molecular weight of 461.41 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 124540993 |
| Molecular Formula | C23H22Cl2N2O2S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C23H22Cl2N2O2S/c24-19-11-8-16(12-20(19)25)14-29-18-9-6-15(7-10-18)13-21-22(28)27(23(30)26-21)17-4-2-1-3-5-17/h6-13,17H,1-5,14H2,(H,26,30)/b21-13- |
| InChIKey | XCKOMWMWNBUSRB-BKUYFWCQSA-N |
| XLogP | 5.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|