C24H25N3O5S — CID 19547717
(5E)-3-cyclohexyl-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547717) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547717 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (5E)-3-cyclohexyl-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(C3CCCCC3)C2=O)cc1COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-31-22-12-7-16(13-17(22)15-32-20-10-8-19(9-11-20)27(29)30)14-21-23(28)26(24(33)25-21)18-5-3-2-4-6-18/h7-14,18H,2-6,15H2,1H3,(H,25,33)/b21-14+ |
| InChIKey | LYIRWQVZASQDQD-KGENOOAVSA-N |
| XLogP | 4.57 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|