C21H18ClN3O5S — CID 19548719
(5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-cyclopropyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548719) has the molecular formula C21H18ClN3O5S and a molecular weight of 459.91 g/mol. Its IUPAC name is (5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-cyclopropyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-cyclopropyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548719 |
| Molecular Formula | C21H18ClN3O5S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | (5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-cyclopropyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(C3CC3)C2=O)cc1COc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H18ClN3O5S/c1-29-18-6-2-12(9-17-20(26)24(14-3-4-14)21(31)23-17)8-13(18)11-30-19-7-5-15(25(27)28)10-16(19)22/h2,5-10,14H,3-4,11H2,1H3,(H,23,31)/b17-9+ |
| InChIKey | GYEZKJIZKUXEOK-RQZCQDPDSA-N |
| XLogP | 4.06 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|