C23H22ClN3O6S — CID 19546247
(5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546247) has the molecular formula C23H22ClN3O6S and a molecular weight of 503.96 g/mol. Its IUPAC name is (5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546247 |
| Molecular Formula | C23H22ClN3O6S |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | (5E)-5-[[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(CC3CCCO3)C2=O)cc1COc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H22ClN3O6S/c1-31-20-6-4-14(9-15(20)13-33-21-7-5-16(27(29)30)11-18(21)24)10-19-22(28)26(23(34)25-19)12-17-3-2-8-32-17/h4-7,9-11,17H,2-3,8,12-13H2,1H3,(H,25,34)/b19-10+ |
| InChIKey | JOJLQDOXAWZFBE-VXLYETTFSA-N |
| XLogP | 4.07 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|