C23H21Cl3N2O4S — CID 19546263
(5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546263) has the molecular formula C23H21Cl3N2O4S and a molecular weight of 527.86 g/mol. Its IUPAC name is (5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546263 |
| Molecular Formula | C23H21Cl3N2O4S |
| Molecular Weight | 527.86 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | (5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(CC3CCCO3)C2=O)cc1COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H21Cl3N2O4S/c1-30-20-5-4-13(7-14(20)12-32-21-10-17(25)16(24)9-18(21)26)8-19-22(29)28(23(33)27-19)11-15-3-2-6-31-15/h4-5,7-10,15H,2-3,6,11-12H2,1H3,(H,27,33)/b19-8+ |
| InChIKey | JZKSIUNWAHCKEH-UFWORHAWSA-N |
| XLogP | 5.47 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.86 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|