C18H20F2N2O4S — CID 51391165
(5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 51391165) has the molecular formula C18H20F2N2O4S and a molecular weight of 398.43 g/mol. Its IUPAC name is (5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 51391165 |
| Molecular Formula | C18H20F2N2O4S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\NC(=S)N(C[C@H]3CCCO3)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C18H20F2N2O4S/c1-2-24-15-9-11(5-6-14(15)26-17(19)20)8-13-16(23)22(18(27)21-13)10-12-4-3-7-25-12/h5-6,8-9,12,17H,2-4,7,10H2,1H3,(H,21,27)/b13-8-/t12-/m1/s1 |
| InChIKey | RTCJSWONFHYOIY-YFBAIUBQSA-N |
| XLogP | 2.92 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|