C24H17Cl3N2O3S — CID 19546052
(5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546052) has the molecular formula C24H17Cl3N2O3S and a molecular weight of 519.84 g/mol. Its IUPAC name is (5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546052 |
| Molecular Formula | C24H17Cl3N2O3S |
| Molecular Weight | 519.84 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | (5E)-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(c3ccccc3)C2=O)cc1COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl3N2O3S/c1-31-21-8-7-14(9-15(21)13-32-22-12-18(26)17(25)11-19(22)27)10-20-23(30)29(24(33)28-20)16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H,28,33)/b20-10+ |
| InChIKey | NTRGQMUXAAURDU-KEBDBYFISA-N |
| XLogP | 6.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|