C20H18N2O4S — CID 6210875
[2-methoxy-5-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl acetate (PubChem CID 6210875) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-methoxy-5-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl acetate.
| Compound Name | [2-methoxy-5-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 6210875 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-methoxy-5-[(E)-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenyl]methyl acetate |
| SMILES | COc1ccc(/C=C2/NC(=S)N(c3ccccc3)C2=O)cc1COC(C)=O |
| InChI | InChI=1S/C20H18N2O4S/c1-13(23)26-12-15-10-14(8-9-18(15)25-2)11-17-19(24)22(20(27)21-17)16-6-4-3-5-7-16/h3-11H,12H2,1-2H3,(H,21,27)/b17-11+ |
| InChIKey | XUFKWKJPQPRJRC-GZTJUZNOSA-N |
| XLogP | 3.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|