C20H16F4N2O3S — CID 19581052
(5Z)-3-(4-fluorophenyl)-5-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19581052) has the molecular formula C20H16F4N2O3S and a molecular weight of 440.42 g/mol. Its IUPAC name is (5Z)-3-(4-fluorophenyl)-5-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(4-fluorophenyl)-5-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19581052 |
| Molecular Formula | C20H16F4N2O3S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (5Z)-3-(4-fluorophenyl)-5-[[4-methoxy-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2\NC(=S)N(c3ccc(F)cc3)C2=O)cc1COCC(F)(F)F |
| InChI | InChI=1S/C20H16F4N2O3S/c1-28-17-7-2-12(8-13(17)10-29-11-20(22,23)24)9-16-18(27)26(19(30)25-16)15-5-3-14(21)4-6-15/h2-9H,10-11H2,1H3,(H,25,30)/b16-9- |
| InChIKey | NHRKGHQCIOETFX-SXGWCWSVSA-N |
| XLogP | 4.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|