C25H20ClFN2O3S — CID 19545817
(5E)-5-[[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19545817) has the molecular formula C25H20ClFN2O3S and a molecular weight of 482.96 g/mol. Its IUPAC name is (5E)-5-[[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19545817 |
| Molecular Formula | C25H20ClFN2O3S |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (5E)-5-[[3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(c3ccc(F)cc3)C2=O)cc1COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C25H20ClFN2O3S/c1-15-11-20(8-9-21(15)26)32-14-17-12-16(3-10-23(17)31-2)13-22-24(30)29(25(33)28-22)19-6-4-18(27)5-7-19/h3-13H,14H2,1-2H3,(H,28,33)/b22-13+ |
| InChIKey | LTAGGTONWJNHJH-LPYMAVHISA-N |
| XLogP | 5.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|