C24H19FN2O2S2 — CID 19545691
(5E)-3-(4-fluorophenyl)-5-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19545691) has the molecular formula C24H19FN2O2S2 and a molecular weight of 450.56 g/mol. Its IUPAC name is (5E)-3-(4-fluorophenyl)-5-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-(4-fluorophenyl)-5-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19545691 |
| Molecular Formula | C24H19FN2O2S2 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (5E)-3-(4-fluorophenyl)-5-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(/C=C2/NC(=S)N(c3ccc(F)cc3)C2=O)ccc1CSc1ccccc1 |
| InChI | InChI=1S/C24H19FN2O2S2/c1-29-22-14-16(7-8-17(22)15-31-20-5-3-2-4-6-20)13-21-23(28)27(24(30)26-21)19-11-9-18(25)10-12-19/h2-14H,15H2,1H3,(H,26,30)/b21-13+ |
| InChIKey | LVUKMWPSYKOSIN-FYJGNVAPSA-N |
| XLogP | 5.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|