C27H24FN3O5S — CID 19545887
2-[2-ethoxy-4-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 19545887) has the molecular formula C27H24FN3O5S and a molecular weight of 521.57 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19545887 |
| Molecular Formula | C27H24FN3O5S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[1-(4-fluorophenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=S)N(c3ccc(F)cc3)C2=O)ccc1OCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C27H24FN3O5S/c1-3-35-24-15-17(14-21-26(33)31(27(37)30-21)19-11-9-18(28)10-12-19)8-13-23(24)36-16-25(32)29-20-6-4-5-7-22(20)34-2/h4-15H,3,16H2,1-2H3,(H,29,32)(H,30,37)/b21-14+ |
| InChIKey | NYUHELYUWCGEHA-KGENOOAVSA-N |
| XLogP | 4.51 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|