C27H25N3O6S — CID 19546981
2-[2-methoxy-4-[(E)-[1-(2-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 19546981) has the molecular formula C27H25N3O6S and a molecular weight of 519.58 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-[1-(2-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-[1-(2-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19546981 |
| Molecular Formula | C27H25N3O6S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-[1-(2-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C2/NC(=S)N(c3ccccc3OC)C2=O)cc1OC |
| InChI | InChI=1S/C27H25N3O6S/c1-33-21-10-6-4-8-18(21)28-25(31)16-36-23-13-12-17(15-24(23)35-3)14-19-26(32)30(27(37)29-19)20-9-5-7-11-22(20)34-2/h4-15H,16H2,1-3H3,(H,28,31)(H,29,37)/b19-14+ |
| InChIKey | HZUKISZQRAFOMZ-XMHGGMMESA-N |
| XLogP | 3.99 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|