C28H27N3O5S — CID 19546519
2-[2-ethoxy-4-[(E)-[1-(3-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 19546519) has the molecular formula C28H27N3O5S and a molecular weight of 517.61 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[1-(3-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-[1-(3-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19546519 |
| Molecular Formula | C28H27N3O5S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[1-(3-methylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=S)N(c3cccc(C)c3)C2=O)ccc1OCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C28H27N3O5S/c1-4-35-25-16-19(15-22-27(33)31(28(37)30-22)20-9-7-8-18(2)14-20)12-13-24(25)36-17-26(32)29-21-10-5-6-11-23(21)34-3/h5-16H,4,17H2,1-3H3,(H,29,32)(H,30,37)/b22-15+ |
| InChIKey | KYFWINNGIFLMRP-PXLXIMEGSA-N |
| XLogP | 4.68 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|