C30H29Cl3N2O5S — CID 19288258
(5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288258) has the molecular formula C30H29Cl3N2O5S and a molecular weight of 636.00 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288258 |
| Molecular Formula | C30H29Cl3N2O5S |
| Molecular Weight | 636.00 g/mol |
| Exact Mass | 634.09 |
| IUPAC Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(2,4,5-trichlorophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3ccc(OC)c(COc4cc(Cl)c(Cl)cc4Cl)c3)NC2=S)cc1OCC |
| InChI | InChI=1S/C30H29Cl3N2O5S/c1-4-38-26-9-6-18(14-28(26)39-5-2)10-11-35-29(36)24(34-30(35)41)13-19-7-8-25(37-3)20(12-19)17-40-27-16-22(32)21(31)15-23(27)33/h6-9,12-16H,4-5,10-11,17H2,1-3H3,(H,34,41)/b24-13+ |
| InChIKey | FFBFKVFGFXGGMY-ZMOGYAJESA-N |
| XLogP | 7.33 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.00 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|