C27H29N5O6S — CID 19288075
(5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288075) has the molecular formula C27H29N5O6S and a molecular weight of 551.63 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288075 |
| Molecular Formula | C27H29N5O6S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3ccc(OC)c(Cn4cc([N+](=O)[O-])cn4)c3)NC2=S)cc1OCC |
| InChI | InChI=1S/C27H29N5O6S/c1-4-37-24-9-6-18(14-25(24)38-5-2)10-11-31-26(33)22(29-27(31)39)13-19-7-8-23(36-3)20(12-19)16-30-17-21(15-28-30)32(34)35/h6-9,12-15,17H,4-5,10-11,16H2,1-3H3,(H,29,39)/b22-13+ |
| InChIKey | GDWUJSGIVAKYJN-LPYMAVHISA-N |
| XLogP | 3.95 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|