C31H33N3O6S — CID 19288289
2-[4-[(E)-[1-[2-(3,4-diethoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide (PubChem CID 19288289) has the molecular formula C31H33N3O6S and a molecular weight of 575.69 g/mol. Its IUPAC name is 2-[4-[(E)-[1-[2-(3,4-diethoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(E)-[1-[2-(3,4-diethoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 19288289 |
| Molecular Formula | C31H33N3O6S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-[4-[(E)-[1-[2-(3,4-diethoxyphenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3ccc(OCC(=O)Nc4ccccc4)c(OC)c3)NC2=S)cc1OCC |
| InChI | InChI=1S/C31H33N3O6S/c1-4-38-26-13-11-21(18-28(26)39-5-2)15-16-34-30(36)24(33-31(34)41)17-22-12-14-25(27(19-22)37-3)40-20-29(35)32-23-9-7-6-8-10-23/h6-14,17-19H,4-5,15-16,20H2,1-3H3,(H,32,35)(H,33,41)/b24-17+ |
| InChIKey | VBJSPWONRBTXBN-JJIBRWJFSA-N |
| XLogP | 4.81 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|