C25H30N2O6S — CID 19288138
(5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one (PubChem CID 19288138) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one.
| Compound Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 19288138 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylidene-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3cc(OC)c(OC)cc3OC)NC2=S)cc1OCC |
| InChI | InChI=1S/C25H30N2O6S/c1-6-32-19-9-8-16(12-23(19)33-7-2)10-11-27-24(28)18(26-25(27)34)13-17-14-21(30-4)22(31-5)15-20(17)29-3/h8-9,12-15H,6-7,10-11H2,1-5H3,(H,26,34)/b18-13+ |
| InChIKey | NEZLALCMXQSGME-QGOAFFKASA-N |
| XLogP | 3.81 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|