C20H23ClN4O3S — CID 135770958
(5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 135770958) has the molecular formula C20H23ClN4O3S and a molecular weight of 434.95 g/mol. Its IUPAC name is (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 135770958 |
| Molecular Formula | C20H23ClN4O3S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3c(Cl)cnn3C)NC2=S)cc1OCC |
| InChI | InChI=1S/C20H23ClN4O3S/c1-4-27-17-7-6-13(10-18(17)28-5-2)8-9-25-19(26)15(23-20(25)29)11-16-14(21)12-22-24(16)3/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,23,29)/b15-11+ |
| InChIKey | ZIBDXCLBEFTPHB-RVDMUPIBSA-N |
| XLogP | 3.17 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|