C10H11ClN4OS — CID 135786581
(5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 135786581) has the molecular formula C10H11ClN4OS and a molecular weight of 270.74 g/mol. Its IUPAC name is (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 135786581 |
| Molecular Formula | C10H11ClN4OS |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2c(Cl)cnn2C)NC1=S |
| InChI | InChI=1S/C10H11ClN4OS/c1-3-15-9(16)7(13-10(15)17)4-8-6(11)5-12-14(8)2/h4-5H,3H2,1-2H3,(H,13,17)/b7-4+ |
| InChIKey | JJLZWXKKGHICND-QPJJXVBHSA-N |
| XLogP | 1.15 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|