C15H13ClN4OS — CID 135786723
(5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 135786723) has the molecular formula C15H13ClN4OS and a molecular weight of 332.82 g/mol. Its IUPAC name is (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 135786723 |
| Molecular Formula | C15H13ClN4OS |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (5E)-5-[(4-chloro-1-methylpyrazol-5-yl)methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccccc1N1C(=O)/C(=C\c2c(Cl)cnn2C)NC1=S |
| InChI | InChI=1S/C15H13ClN4OS/c1-9-5-3-4-6-12(9)20-14(21)11(18-15(20)22)7-13-10(16)8-17-19(13)2/h3-8H,1-2H3,(H,18,22)/b11-7+ |
| InChIKey | FMDPEFKRRNZOHN-YRNVUSSQSA-N |
| XLogP | 2.64 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|