C23H19ClN2O3S — CID 19548025
(5E)-5-[[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548025) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is (5E)-5-[[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548025 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (5E)-5-[[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]methylidene]-3-(2-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccccc1N1C(=O)/C(=C\c2ccc(COc3cccc(Cl)c3C)o2)NC1=S |
| InChI | InChI=1S/C23H19ClN2O3S/c1-14-6-3-4-8-20(14)26-22(27)19(25-23(26)30)12-16-10-11-17(29-16)13-28-21-9-5-7-18(24)15(21)2/h3-12H,13H2,1-2H3,(H,25,30)/b19-12+ |
| InChIKey | UGYOOOXBVIEAAI-XDHOZWIPSA-N |
| XLogP | 5.39 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|