C22H16ClFN2O4S — CID 19546869
(5E)-5-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546869) has the molecular formula C22H16ClFN2O4S and a molecular weight of 458.90 g/mol. Its IUPAC name is (5E)-5-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546869 |
| Molecular Formula | C22H16ClFN2O4S |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | (5E)-5-[[5-[(2-chloro-4-fluorophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccccc1N1C(=O)/C(=C\c2ccc(COc3ccc(F)cc3Cl)o2)NC1=S |
| InChI | InChI=1S/C22H16ClFN2O4S/c1-28-20-5-3-2-4-18(20)26-21(27)17(25-22(26)31)11-14-7-8-15(30-14)12-29-19-9-6-13(24)10-16(19)23/h2-11H,12H2,1H3,(H,25,31)/b17-11+ |
| InChIKey | QYKMDYPMHYCSJY-GZTJUZNOSA-N |
| XLogP | 4.92 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|