C22H17BrN2O4S — CID 19546864
(5E)-5-[[5-[(2-bromophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546864) has the molecular formula C22H17BrN2O4S and a molecular weight of 485.36 g/mol. Its IUPAC name is (5E)-5-[[5-[(2-bromophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(2-bromophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546864 |
| Molecular Formula | C22H17BrN2O4S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | (5E)-5-[[5-[(2-bromophenoxy)methyl]furan-2-yl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccccc1N1C(=O)/C(=C\c2ccc(COc3ccccc3Br)o2)NC1=S |
| InChI | InChI=1S/C22H17BrN2O4S/c1-27-20-9-5-3-7-18(20)25-21(26)17(24-22(25)30)12-14-10-11-15(29-14)13-28-19-8-4-2-6-16(19)23/h2-12H,13H2,1H3,(H,24,30)/b17-12+ |
| InChIKey | NAOLIFKMEJATGW-SFQUDFHCSA-N |
| XLogP | 4.89 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|