C14H10BrFN4OS — CID 135786592
(5E)-5-[(4-bromo-1-methylpyrazol-5-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 135786592) has the molecular formula C14H10BrFN4OS and a molecular weight of 381.23 g/mol. Its IUPAC name is (5E)-5-[(4-bromo-1-methylpyrazol-5-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-bromo-1-methylpyrazol-5-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 135786592 |
| Molecular Formula | C14H10BrFN4OS |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | (5E)-5-[(4-bromo-1-methylpyrazol-5-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cn1ncc(Br)c1/C=C1/NC(=S)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C14H10BrFN4OS/c1-19-12(10(15)7-17-19)6-11-13(21)20(14(22)18-11)9-4-2-8(16)3-5-9/h2-7H,1H3,(H,18,22)/b11-6+ |
| InChIKey | CCWRKVKQSQGTII-IZZDOVSWSA-N |
| XLogP | 2.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|