C16H13FN2OS2 — CID 19545849
(5E)-5-[(2,5-dimethylthiophen-3-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19545849) has the molecular formula C16H13FN2OS2 and a molecular weight of 332.43 g/mol. Its IUPAC name is (5E)-5-[(2,5-dimethylthiophen-3-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(2,5-dimethylthiophen-3-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19545849 |
| Molecular Formula | C16H13FN2OS2 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (5E)-5-[(2,5-dimethylthiophen-3-yl)methylidene]-3-(4-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1cc(/C=C2/NC(=S)N(c3ccc(F)cc3)C2=O)c(C)s1 |
| InChI | InChI=1S/C16H13FN2OS2/c1-9-7-11(10(2)22-9)8-14-15(20)19(16(21)18-14)13-5-3-12(17)4-6-13/h3-8H,1-2H3,(H,18,21)/b14-8+ |
| InChIKey | GICPQRJIBOCOEK-RIYZIHGNSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|