C27H23Cl5N2O5S — CID 19288154
(5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288154) has the molecular formula C27H23Cl5N2O5S and a molecular weight of 664.82 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288154 |
| Molecular Formula | C27H23Cl5N2O5S |
| Molecular Weight | 664.82 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3ccc(COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)o3)NC2=S)cc1OCC |
| InChI | InChI=1S/C27H23Cl5N2O5S/c1-3-36-18-8-5-14(11-19(18)37-4-2)9-10-34-26(35)17(33-27(34)40)12-15-6-7-16(39-15)13-38-25-23(31)21(29)20(28)22(30)24(25)32/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H,33,40)/b17-12+ |
| InChIKey | LUGCQMPBWDJVLV-SFQUDFHCSA-N |
| XLogP | 8.22 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.82 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|