C21H18Cl2N4O3S — CID 19289817
(5E)-5-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19289817) has the molecular formula C21H18Cl2N4O3S and a molecular weight of 477.37 g/mol. Its IUPAC name is (5E)-5-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19289817 |
| Molecular Formula | C21H18Cl2N4O3S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (5E)-5-[[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(CN2C(=O)/C(=C\c3ccc(COc4ccc(Cl)cc4Cl)o3)NC2=S)cn1 |
| InChI | InChI=1S/C21H18Cl2N4O3S/c1-2-26-10-13(9-24-26)11-27-20(28)18(25-21(27)31)8-15-4-5-16(30-15)12-29-19-6-3-14(22)7-17(19)23/h3-10H,2,11-12H2,1H3,(H,25,31)/b18-8+ |
| InChIKey | HMAYKEJSBLKSIQ-QGMBQPNBSA-N |
| XLogP | 4.64 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|