C24H23BrN4O3S — CID 19288305
(5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288305) has the molecular formula C24H23BrN4O3S and a molecular weight of 527.44 g/mol. Its IUPAC name is (5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288305 |
| Molecular Formula | C24H23BrN4O3S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | (5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(CN2C(=O)/C(=C\c3ccc(OC)c(COc4ccccc4Br)c3)NC2=S)cn1 |
| InChI | InChI=1S/C24H23BrN4O3S/c1-3-28-13-17(12-26-28)14-29-23(30)20(27-24(29)33)11-16-8-9-21(31-2)18(10-16)15-32-22-7-5-4-6-19(22)25/h4-13H,3,14-15H2,1-2H3,(H,27,33)/b20-11+ |
| InChIKey | LPZFZSOXIJDEQS-RGVLZGJSSA-N |
| XLogP | 4.51 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|