C17H18N4O2S — CID 19288335
(5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[(3-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288335) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[(3-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[(3-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288335 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[(3-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(CN2C(=O)/C(=C\c3cccc(OC)c3)NC2=S)cn1 |
| InChI | InChI=1S/C17H18N4O2S/c1-3-20-10-13(9-18-20)11-21-16(22)15(19-17(21)24)8-12-5-4-6-14(7-12)23-2/h4-10H,3,11H2,1-2H3,(H,19,24)/b15-8+ |
| InChIKey | ULZKXUSFTGJHTR-OVCLIPMQSA-N |
| XLogP | 2.17 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|