C24H23N5O5S — CID 19289846
(5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19289846) has the molecular formula C24H23N5O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19289846 |
| Molecular Formula | C24H23N5O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(CN2C(=O)/C(=C\c3ccc(OC)c(COc4cccc([N+](=O)[O-])c4)c3)NC2=S)cn1 |
| InChI | InChI=1S/C24H23N5O5S/c1-3-27-13-17(12-25-27)14-28-23(30)21(26-24(28)35)10-16-7-8-22(33-2)18(9-16)15-34-20-6-4-5-19(11-20)29(31)32/h4-13H,3,14-15H2,1-2H3,(H,26,35)/b21-10+ |
| InChIKey | VNVORTRXENOVLR-UFFVCSGVSA-N |
| XLogP | 3.66 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|