C25H21N3O5S — CID 19546460
(5E)-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546460) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is (5E)-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546460 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | (5E)-5-[[4-methoxy-3-[(3-nitrophenoxy)methyl]phenyl]methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(c3cccc(C)c3)C2=O)cc1COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21N3O5S/c1-16-5-3-6-19(11-16)27-24(29)22(26-25(27)34)13-17-9-10-23(32-2)18(12-17)15-33-21-8-4-7-20(14-21)28(30)31/h3-14H,15H2,1-2H3,(H,26,34)/b22-13+ |
| InChIKey | RLEUBMKYRRSFAV-LPYMAVHISA-N |
| XLogP | 4.75 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|